C9H12FN5OS — CID 170791998
[4-[(1-ethylpyrazol-4-yl)-hydroxymethyl]-5-methyltriazol-2-yl] thiohypofluorite (PubChem CID 170791998) has the molecular formula C9H12FN5OS and a molecular weight of 257.29 g/mol. Its IUPAC name is [4-[(1-ethylpyrazol-4-yl)-hydroxymethyl]-5-methyltriazol-2-yl] thiohypofluorite.
| Compound Name | [4-[(1-ethylpyrazol-4-yl)-hydroxymethyl]-5-methyltriazol-2-yl] thiohypofluorite |
|---|---|
| PubChem CID | 170791998 |
| Molecular Formula | C9H12FN5OS |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | [4-[(1-ethylpyrazol-4-yl)-hydroxymethyl]-5-methyltriazol-2-yl] thiohypofluorite |
| SMILES | CCn1cc(C(O)c2nn(SF)nc2C)cn1 |
| InChI | InChI=1S/C9H12FN5OS/c1-3-14-5-7(4-11-14)9(16)8-6(2)12-15(13-8)17-10/h4-5,9,16H,3H2,1-2H3 |
| InChIKey | MYBSPIIFNCORIS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |