About 3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane
3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane (PubChem CID 170792341) has the molecular formula C10H13NO3S
and a molecular weight of 227.28 g/mol. Its IUPAC name is 3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane.
Molecular Properties
| Compound Name | 3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane |
| PubChem CID | 170792341 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane |
| SMILES | C=C(/C=C\C(=C)[N+](=O)[O-])OC1CCSC1 |
| InChI | InChI=1S/C10H13NO3S/c1-8(11(12)13)3-4-9(2)14-10-5-6-15-7-10/h3-4,10H,1-2,5-7H2/b4-3- |
| InChIKey | PQTGIYPOCWTOJR-ARJAWSKDSA-N |
| XLogP | 2.37 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane?
The IUPAC name of 3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane (CID 170792341) is 3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane.
What is the SMILES notation for 3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane?
The canonical SMILES for 3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane is C=C(/C=C\C(=C)[N+](=O)[O-])OC1CCSC1.
What is the InChIKey of 3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane?
The InChIKey is PQTGIYPOCWTOJR-ARJAWSKDSA-N. The full InChI is InChI=1S/C10H13NO3S/c1-8(11(12)13)3-4-9(2)14-10-5-6-15-7-10/h3-4,10H,1-2,5-7H2/b4-3-.
What are the key properties of 3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane?
3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane has a molecular weight of 227.28 g/mol, XLogP of 2.37, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3Z)-5-nitrohexa-1,3,5-trien-2-yl]oxythiolane is sourced from PubChem (CID 170792341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).