C25H26FN3O4 — CID 170792459
(3S,4R)-4-[2-fluoro-4-[4-[(3S)-4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]anilino]oxolan-3-ol (PubChem CID 170792459) has the molecular formula C25H26FN3O4 and a molecular weight of 451.50 g/mol. Its IUPAC name is (3S,4R)-4-[2-fluoro-4-[4-[(3S)-4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]anilino]oxolan-3-ol.
| Compound Name | (3S,4R)-4-[2-fluoro-4-[4-[(3S)-4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]anilino]oxolan-3-ol |
|---|---|
| PubChem CID | 170792459 |
| Molecular Formula | C25H26FN3O4 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (3S,4R)-4-[2-fluoro-4-[4-[(3S)-4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]anilino]oxolan-3-ol |
| SMILES | C[C@H](O)c1nccn1[C@@H](C#Cc1ccc(-c2ccc(N[C@@H]3COC[C@H]3O)c(F)c2)cc1)CO |
| InChI | InChI=1S/C25H26FN3O4/c1-16(31)25-27-10-11-29(25)20(13-30)8-4-17-2-5-18(6-3-17)19-7-9-22(21(26)12-19)28-23-14-33-15-24(23)32/h2-3,5-7,9-12,16,20,23-24,28,30-32H,13-15H2,1H3/t16-,20-,23+,24+/m0/s1 |
| InChIKey | GMDRVYOXIFZRLV-OCIAECLNSA-N |
| XLogP | 2.50 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|