C27H30N4O3 — CID 170792795
4-[4-(4-cyclobutyloxyphenyl)phenyl]-2-[2-(hydroxymethyl)imidazol-1-yl]but-3-yn-1-ol;2-(methylamino)acetonitrile (PubChem CID 170792795) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is 4-[4-(4-cyclobutyloxyphenyl)phenyl]-2-[2-(hydroxymethyl)imidazol-1-yl]but-3-yn-1-ol;2-(methylamino)acetonitrile.
| Compound Name | 4-[4-(4-cyclobutyloxyphenyl)phenyl]-2-[2-(hydroxymethyl)imidazol-1-yl]but-3-yn-1-ol;2-(methylamino)acetonitrile |
|---|---|
| PubChem CID | 170792795 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 4-[4-(4-cyclobutyloxyphenyl)phenyl]-2-[2-(hydroxymethyl)imidazol-1-yl]but-3-yn-1-ol;2-(methylamino)acetonitrile |
| SMILES | CNCC#N.OCc1nccn1C(C#Cc1ccc(-c2ccc(OC3CCC3)cc2)cc1)CO |
| InChI | InChI=1S/C24H24N2O3.C3H6N2/c27-16-21(26-15-14-25-24(26)17-28)11-6-18-4-7-19(8-5-18)20-9-12-23(13-10-20)29-22-2-1-3-22;1-5-3-2-4/h4-5,7-10,12-15,21-22,27-28H,1-3,16-17H2;5H,3H2,1H3 |
| InChIKey | CPZQQKININSIND-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|