C25H26F5N7O — CID 170793812
1-[2-[4-[1-(2,4-difluorophenyl)-2,2,2-trifluoroethyl]piperazin-1-yl]-3-(1-methylpyrazol-4-yl)-7,8-dihydro-5H-pyrido[3,4-b]pyrazin-6-yl]ethanone (PubChem CID 170793812) has the molecular formula C25H26F5N7O and a molecular weight of 535.52 g/mol. Its IUPAC name is 1-[2-[4-[1-(2,4-difluorophenyl)-2,2,2-trifluoroethyl]piperazin-1-yl]-3-(1-methylpyrazol-4-yl)-7,8-dihydro-5H-pyrido[3,4-b]pyrazin-6-yl]ethanone.
| Compound Name | 1-[2-[4-[1-(2,4-difluorophenyl)-2,2,2-trifluoroethyl]piperazin-1-yl]-3-(1-methylpyrazol-4-yl)-7,8-dihydro-5H-pyrido[3,4-b]pyrazin-6-yl]ethanone |
|---|---|
| PubChem CID | 170793812 |
| Molecular Formula | C25H26F5N7O |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 1-[2-[4-[1-(2,4-difluorophenyl)-2,2,2-trifluoroethyl]piperazin-1-yl]-3-(1-methylpyrazol-4-yl)-7,8-dihydro-5H-pyrido[3,4-b]pyrazin-6-yl]ethanone |
| SMILES | CC(=O)N1CCc2nc(N3CCN(C(c4ccc(F)cc4F)C(F)(F)F)CC3)c(-c3cnn(C)c3)nc2C1 |
| InChI | InChI=1S/C25H26F5N7O/c1-15(38)37-6-5-20-21(14-37)32-22(16-12-31-34(2)13-16)24(33-20)36-9-7-35(8-10-36)23(25(28,29)30)18-4-3-17(26)11-19(18)27/h3-4,11-13,23H,5-10,14H2,1-2H3 |
| InChIKey | AAGLMKBOEOGQLZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |