C24H38O5 — CID 170794373
11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethane (PubChem CID 170794373) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is 11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethane.
| Compound Name | 11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethane |
|---|---|
| PubChem CID | 170794373 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethane |
| SMILES | CC.CC1CC2C(C(O)CC3(C)C2CCC3(O)C(=O)CO)C2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C22H32O5.C2H6/c1-12-8-14-15-5-7-22(27,18(26)11-23)21(15,3)10-17(25)19(14)20(2)6-4-13(24)9-16(12)20;1-2/h9,12,14-15,17,19,23,25,27H,4-8,10-11H2,1-3H3;1-2H3 |
| InChIKey | LJDJMVHLCQGNNC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |