C17H18ClN5O2 — CID 170795272
[6-(6-chloro-5-methoxy-3-pyrazolidin-4-ylindol-1-yl)pyridazin-3-yl]methanol (PubChem CID 170795272) has the molecular formula C17H18ClN5O2 and a molecular weight of 359.82 g/mol. Its IUPAC name is [6-(6-chloro-5-methoxy-3-pyrazolidin-4-ylindol-1-yl)pyridazin-3-yl]methanol.
| Compound Name | [6-(6-chloro-5-methoxy-3-pyrazolidin-4-ylindol-1-yl)pyridazin-3-yl]methanol |
|---|---|
| PubChem CID | 170795272 |
| Molecular Formula | C17H18ClN5O2 |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [6-(6-chloro-5-methoxy-3-pyrazolidin-4-ylindol-1-yl)pyridazin-3-yl]methanol |
| SMILES | COc1cc2c(C3CNNC3)cn(-c3ccc(CO)nn3)c2cc1Cl |
| InChI | InChI=1S/C17H18ClN5O2/c1-25-16-4-12-13(10-6-19-20-7-10)8-23(15(12)5-14(16)18)17-3-2-11(9-24)21-22-17/h2-5,8,10,19-20,24H,6-7,9H2,1H3 |
| InChIKey | FJLJWSNIKUOCFR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |