C22H27N7O — CID 170795318
6-methyl-3-[[8-[(2R)-2-methylpiperidin-1-yl]pyrido[3,4-d]pyrimidin-2-yl]amino]-4a,5,7,8-tetrahydro-1,6-naphthyridin-2-one (PubChem CID 170795318) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is 6-methyl-3-[[8-[(2R)-2-methylpiperidin-1-yl]pyrido[3,4-d]pyrimidin-2-yl]amino]-4a,5,7,8-tetrahydro-1,6-naphthyridin-2-one.
| Compound Name | 6-methyl-3-[[8-[(2R)-2-methylpiperidin-1-yl]pyrido[3,4-d]pyrimidin-2-yl]amino]-4a,5,7,8-tetrahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 170795318 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 6-methyl-3-[[8-[(2R)-2-methylpiperidin-1-yl]pyrido[3,4-d]pyrimidin-2-yl]amino]-4a,5,7,8-tetrahydro-1,6-naphthyridin-2-one |
| SMILES | C[C@@H]1CCCCN1c1nccc2cnc(NC3=CC4CN(C)CCC4=NC3=O)nc12 |
| InChI | InChI=1S/C22H27N7O/c1-14-5-3-4-9-29(14)20-19-15(6-8-23-20)12-24-22(27-19)26-18-11-16-13-28(2)10-7-17(16)25-21(18)30/h6,8,11-12,14,16H,3-5,7,9-10,13H2,1-2H3,(H,24,26,27)/t14-,16?/m1/s1 |
| InChIKey | QVPXEFPBZLVBKL-IURRXHLWSA-N |
| XLogP | 2.63 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |