About [5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid
[5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid (PubChem CID 170795418) has the molecular formula C15H21BF2N6O3
and a molecular weight of 382.18 g/mol. Its IUPAC name is [5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid.
Molecular Properties
| Compound Name | [5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid |
| PubChem CID | 170795418 |
| Molecular Formula | C15H21BF2N6O3 |
| Molecular Weight | 382.18 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | [5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid |
| SMILES | NC(CCCCB(O)O)c1nnnn1CC(=O)NCc1c(F)cccc1F |
| InChI | InChI=1S/C15H21BF2N6O3/c17-11-4-3-5-12(18)10(11)8-20-14(25)9-24-15(21-22-23-24)13(19)6-1-2-7-16(26)27/h3-5,13,26-27H,1-2,6-9,19H2,(H,20,25) |
| InChIKey | GNCFZEUNYCJGJL-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.18 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid?
The IUPAC name of [5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid (CID 170795418) is [5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid.
What is the SMILES notation for [5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid?
The canonical SMILES for [5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid is NC(CCCCB(O)O)c1nnnn1CC(=O)NCc1c(F)cccc1F.
What is the InChIKey of [5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid?
The InChIKey is GNCFZEUNYCJGJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BF2N6O3/c17-11-4-3-5-12(18)10(11)8-20-14(25)9-24-15(21-22-23-24)13(19)6-1-2-7-16(26)27/h3-5,13,26-27H,1-2,6-9,19H2,(H,20,25).
What are the key properties of [5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid?
[5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid has a molecular weight of 382.18 g/mol, XLogP of -0.09, 10 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5-amino-5-[1-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentyl]boronic acid is sourced from PubChem (CID 170795418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).