C15H19BF4N6O3 — CID 170795439
[5-amino-5-[1-[2-oxo-2-[(2,3,5,6-tetrafluorophenyl)methylamino]ethyl]tetrazol-5-yl]pentyl]boronic acid (PubChem CID 170795439) has the molecular formula C15H19BF4N6O3 and a molecular weight of 418.16 g/mol. Its IUPAC name is [5-amino-5-[1-[2-oxo-2-[(2,3,5,6-tetrafluorophenyl)methylamino]ethyl]tetrazol-5-yl]pentyl]boronic acid.
| Compound Name | [5-amino-5-[1-[2-oxo-2-[(2,3,5,6-tetrafluorophenyl)methylamino]ethyl]tetrazol-5-yl]pentyl]boronic acid |
|---|---|
| PubChem CID | 170795439 |
| Molecular Formula | C15H19BF4N6O3 |
| Molecular Weight | 418.16 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [5-amino-5-[1-[2-oxo-2-[(2,3,5,6-tetrafluorophenyl)methylamino]ethyl]tetrazol-5-yl]pentyl]boronic acid |
| SMILES | NC(CCCCB(O)O)c1nnnn1CC(=O)NCc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C15H19BF4N6O3/c17-9-5-10(18)14(20)8(13(9)19)6-22-12(27)7-26-15(23-24-25-26)11(21)3-1-2-4-16(28)29/h5,11,28-29H,1-4,6-7,21H2,(H,22,27) |
| InChIKey | XKHYNCHERHLJQS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|