C16H26BN7O4S — CID 170795463
[5-amino-5-[1-[5-amino-2-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]tetrazol-5-yl]pentyl]boronic acid (PubChem CID 170795463) has the molecular formula C16H26BN7O4S and a molecular weight of 423.31 g/mol. Its IUPAC name is [5-amino-5-[1-[5-amino-2-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]tetrazol-5-yl]pentyl]boronic acid.
| Compound Name | [5-amino-5-[1-[5-amino-2-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]tetrazol-5-yl]pentyl]boronic acid |
|---|---|
| PubChem CID | 170795463 |
| Molecular Formula | C16H26BN7O4S |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [5-amino-5-[1-[5-amino-2-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]tetrazol-5-yl]pentyl]boronic acid |
| SMILES | Nc1ccc(N2CCS(=O)(=O)CC2)c(-n2nnnc2C(N)CCCCB(O)O)c1 |
| InChI | InChI=1S/C16H26BN7O4S/c18-12-4-5-14(23-7-9-29(27,28)10-8-23)15(11-12)24-16(20-21-22-24)13(19)3-1-2-6-17(25)26/h4-5,11,13,25-26H,1-3,6-10,18-19H2 |
| InChIKey | UPWFCCHYLJXVAZ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 173.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|