C12H12F2O2 — CID 170795691
ethyl 4-(2,4-difluorophenyl)but-3-enoate (PubChem CID 170795691) has the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. Its IUPAC name is ethyl 4-(2,4-difluorophenyl)but-3-enoate.
| Compound Name | ethyl 4-(2,4-difluorophenyl)but-3-enoate |
|---|---|
| PubChem CID | 170795691 |
| Molecular Formula | C12H12F2O2 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | ethyl 4-(2,4-difluorophenyl)but-3-enoate |
| SMILES | CCOC(=O)CC=Cc1ccc(F)cc1F |
| InChI | InChI=1S/C12H12F2O2/c1-2-16-12(15)5-3-4-9-6-7-10(13)8-11(9)14/h3-4,6-8H,2,5H2,1H3 |
| InChIKey | PTOBPZGWMJOBLJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |