C13H13ClO4 — CID 170796298
ethyl 4-(6-chloro-1,3-benzodioxol-5-yl)but-3-enoate (PubChem CID 170796298) has the molecular formula C13H13ClO4 and a molecular weight of 268.70 g/mol. Its IUPAC name is ethyl 4-(6-chloro-1,3-benzodioxol-5-yl)but-3-enoate.
| Compound Name | ethyl 4-(6-chloro-1,3-benzodioxol-5-yl)but-3-enoate |
|---|---|
| PubChem CID | 170796298 |
| Molecular Formula | C13H13ClO4 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | ethyl 4-(6-chloro-1,3-benzodioxol-5-yl)but-3-enoate |
| SMILES | CCOC(=O)CC=Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C13H13ClO4/c1-2-16-13(15)5-3-4-9-6-11-12(7-10(9)14)18-8-17-11/h3-4,6-7H,2,5,8H2,1H3 |
| InChIKey | YFGOQIQZLFMRMG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |