About ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate
ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate (PubChem CID 170796317) has the molecular formula C12H12N2O4
and a molecular weight of 248.24 g/mol. Its IUPAC name is ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate.
Molecular Properties
| Compound Name | ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate |
| PubChem CID | 170796317 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate |
| SMILES | CCOC(=O)CC=Cc1cnc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C12H12N2O4/c1-2-17-10(15)5-3-4-8-6-9-11(13-7-8)14-12(16)18-9/h3-4,6-7H,2,5H2,1H3,(H,13,14,16) |
| InChIKey | BQZUPPSPFGDXNK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate?
The IUPAC name of ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate (CID 170796317) is ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate.
What is the SMILES notation for ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate?
The canonical SMILES for ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate is CCOC(=O)CC=Cc1cnc2[nH]c(=O)oc2c1.
What is the InChIKey of ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate?
The InChIKey is BQZUPPSPFGDXNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4/c1-2-17-10(15)5-3-4-8-6-9-11(13-7-8)14-12(16)18-9/h3-4,6-7H,2,5H2,1H3,(H,13,14,16).
What are the key properties of ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate?
ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate has a molecular weight of 248.24 g/mol, XLogP of 1.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-enoate is sourced from PubChem (CID 170796317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).