C14H15NO3 — CID 170796345
ethyl 4-(3-oxo-1,2-dihydroisoindol-5-yl)but-3-enoate (PubChem CID 170796345) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is ethyl 4-(3-oxo-1,2-dihydroisoindol-5-yl)but-3-enoate.
| Compound Name | ethyl 4-(3-oxo-1,2-dihydroisoindol-5-yl)but-3-enoate |
|---|---|
| PubChem CID | 170796345 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | ethyl 4-(3-oxo-1,2-dihydroisoindol-5-yl)but-3-enoate |
| SMILES | CCOC(=O)CC=Cc1ccc2c(c1)C(=O)NC2 |
| InChI | InChI=1S/C14H15NO3/c1-2-18-13(16)5-3-4-10-6-7-11-9-15-14(17)12(11)8-10/h3-4,6-8H,2,5,9H2,1H3,(H,15,17) |
| InChIKey | CFRSGJKLBSNTOU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |