C15H15NO4 — CID 170796928
5-(4-ethoxy-4-oxobut-1-enyl)-1H-indole-3-carboxylic acid (PubChem CID 170796928) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 5-(4-ethoxy-4-oxobut-1-enyl)-1H-indole-3-carboxylic acid.
| Compound Name | 5-(4-ethoxy-4-oxobut-1-enyl)-1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 170796928 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 5-(4-ethoxy-4-oxobut-1-enyl)-1H-indole-3-carboxylic acid |
| SMILES | CCOC(=O)CC=Cc1ccc2[nH]cc(C(=O)O)c2c1 |
| InChI | InChI=1S/C15H15NO4/c1-2-20-14(17)5-3-4-10-6-7-13-11(8-10)12(9-16-13)15(18)19/h3-4,6-9,16H,2,5H2,1H3,(H,18,19) |
| InChIKey | KTQZYHHTYPMZNC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |