About 4-(2-amino-1,3-thiazol-5-yl)but-3-enamide
4-(2-amino-1,3-thiazol-5-yl)but-3-enamide (PubChem CID 170797289) has the molecular formula C7H9N3OS
and a molecular weight of 183.24 g/mol. Its IUPAC name is 4-(2-amino-1,3-thiazol-5-yl)but-3-enamide.
Molecular Properties
| Compound Name | 4-(2-amino-1,3-thiazol-5-yl)but-3-enamide |
| PubChem CID | 170797289 |
| Molecular Formula | C7H9N3OS |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 4-(2-amino-1,3-thiazol-5-yl)but-3-enamide |
| SMILES | NC(=O)CC=Cc1cnc(N)s1 |
| InChI | InChI=1S/C7H9N3OS/c8-6(11)3-1-2-5-4-10-7(9)12-5/h1-2,4H,3H2,(H2,8,11)(H2,9,10) |
| InChIKey | RUZWTAIVMXFUPZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-amino-1,3-thiazol-5-yl)but-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-1,3-thiazol-5-yl)but-3-enamide?
The IUPAC name of 4-(2-amino-1,3-thiazol-5-yl)but-3-enamide (CID 170797289) is 4-(2-amino-1,3-thiazol-5-yl)but-3-enamide.
What is the SMILES notation for 4-(2-amino-1,3-thiazol-5-yl)but-3-enamide?
The canonical SMILES for 4-(2-amino-1,3-thiazol-5-yl)but-3-enamide is NC(=O)CC=Cc1cnc(N)s1.
What is the InChIKey of 4-(2-amino-1,3-thiazol-5-yl)but-3-enamide?
The InChIKey is RUZWTAIVMXFUPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3OS/c8-6(11)3-1-2-5-4-10-7(9)12-5/h1-2,4H,3H2,(H2,8,11)(H2,9,10).
What are the key properties of 4-(2-amino-1,3-thiazol-5-yl)but-3-enamide?
4-(2-amino-1,3-thiazol-5-yl)but-3-enamide has a molecular weight of 183.24 g/mol, XLogP of 0.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-1,3-thiazol-5-yl)but-3-enamide is sourced from PubChem (CID 170797289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).