C13H12N2O2S — CID 170798712
4-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]but-3-enamide (PubChem CID 170798712) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 4-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]but-3-enamide.
| Compound Name | 4-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]but-3-enamide |
|---|---|
| PubChem CID | 170798712 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]but-3-enamide |
| SMILES | NC(=O)CC=Cc1ccc(-c2csc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C13H12N2O2S/c14-12(16)3-1-2-9-4-6-10(7-5-9)11-8-18-13(17)15-11/h1-2,4-8H,3H2,(H2,14,16)(H,15,17) |
| InChIKey | AXFFDMGCRWIIDJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |