C14H14N2O2 — CID 170798715
4-(2-methyl-4-oxo-1H-quinolin-6-yl)but-3-enamide (PubChem CID 170798715) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-(2-methyl-4-oxo-1H-quinolin-6-yl)but-3-enamide.
| Compound Name | 4-(2-methyl-4-oxo-1H-quinolin-6-yl)but-3-enamide |
|---|---|
| PubChem CID | 170798715 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-(2-methyl-4-oxo-1H-quinolin-6-yl)but-3-enamide |
| SMILES | Cc1cc(=O)c2cc(C=CCC(N)=O)ccc2[nH]1 |
| InChI | InChI=1S/C14H14N2O2/c1-9-7-13(17)11-8-10(3-2-4-14(15)18)5-6-12(11)16-9/h2-3,5-8H,4H2,1H3,(H2,15,18)(H,16,17) |
| InChIKey | YHXHTPCVGOXCBN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |