C19H19NO — CID 170798912
4-(9,9-dimethylfluoren-2-yl)but-3-enamide (PubChem CID 170798912) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-(9,9-dimethylfluoren-2-yl)but-3-enamide.
| Compound Name | 4-(9,9-dimethylfluoren-2-yl)but-3-enamide |
|---|---|
| PubChem CID | 170798912 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 4-(9,9-dimethylfluoren-2-yl)but-3-enamide |
| SMILES | CC1(C)c2ccccc2-c2ccc(C=CCC(N)=O)cc21 |
| InChI | InChI=1S/C19H19NO/c1-19(2)16-8-4-3-7-14(16)15-11-10-13(12-17(15)19)6-5-9-18(20)21/h3-8,10-12H,9H2,1-2H3,(H2,20,21) |
| InChIKey | SFAKRPAGZDKORC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |