About 4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile
4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile (PubChem CID 170799835) has the molecular formula C10H8N4
and a molecular weight of 184.20 g/mol. Its IUPAC name is 4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile.
Molecular Properties
| Compound Name | 4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile |
| PubChem CID | 170799835 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile |
| SMILES | N#CCC=Cc1cc2cn[nH]c2cn1 |
| InChI | InChI=1S/C10H8N4/c11-4-2-1-3-9-5-8-6-13-14-10(8)7-12-9/h1,3,5-7H,2H2,(H,13,14) |
| InChIKey | JBJCYZRSPZIVDT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile?
The IUPAC name of 4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile (CID 170799835) is 4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile.
What is the SMILES notation for 4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile?
The canonical SMILES for 4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile is N#CCC=Cc1cc2cn[nH]c2cn1.
What is the InChIKey of 4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile?
The InChIKey is JBJCYZRSPZIVDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4/c11-4-2-1-3-9-5-8-6-13-14-10(8)7-12-9/h1,3,5-7H,2H2,(H,13,14).
What are the key properties of 4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile?
4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile has a molecular weight of 184.20 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-pyrazolo[3,4-c]pyridin-5-yl)but-3-enenitrile is sourced from PubChem (CID 170799835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).