C13H13NO2 — CID 170800220
4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid (PubChem CID 170800220) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid.
| Compound Name | 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 170800220 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid |
| SMILES | Cc1cc(C=CCC#N)cc(C)c1C(=O)O |
| InChI | InChI=1S/C13H13NO2/c1-9-7-11(5-3-4-6-14)8-10(2)12(9)13(15)16/h3,5,7-8H,4H2,1-2H3,(H,15,16) |
| InChIKey | JIIHEBLCURQQOJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |