About 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid
4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid (PubChem CID 170800220) has the molecular formula C13H13NO2
and a molecular weight of 215.25 g/mol. Its IUPAC name is 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid |
| PubChem CID | 170800220 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid |
| SMILES | Cc1cc(C=CCC#N)cc(C)c1C(=O)O |
| InChI | InChI=1S/C13H13NO2/c1-9-7-11(5-3-4-6-14)8-10(2)12(9)13(15)16/h3,5,7-8H,4H2,1-2H3,(H,15,16) |
| InChIKey | JIIHEBLCURQQOJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid?
The IUPAC name of 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid (CID 170800220) is 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid.
What is the SMILES notation for 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid?
The canonical SMILES for 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid is Cc1cc(C=CCC#N)cc(C)c1C(=O)O.
What is the InChIKey of 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid?
The InChIKey is JIIHEBLCURQQOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2/c1-9-7-11(5-3-4-6-14)8-10(2)12(9)13(15)16/h3,5,7-8H,4H2,1-2H3,(H,15,16).
What are the key properties of 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid?
4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid has a molecular weight of 215.25 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-cyanoprop-1-enyl)-2,6-dimethylbenzoic acid is sourced from PubChem (CID 170800220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).