C16H20N2O2 — CID 17080667
1-(2-methylphenyl)-4-(pyrrolidine-1-carbonyl)pyrrolidin-2-one (PubChem CID 17080667) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-(2-methylphenyl)-4-(pyrrolidine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(2-methylphenyl)-4-(pyrrolidine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 17080667 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-(2-methylphenyl)-4-(pyrrolidine-1-carbonyl)pyrrolidin-2-one |
| SMILES | Cc1ccccc1N1CC(C(=O)N2CCCC2)CC1=O |
| InChI | InChI=1S/C16H20N2O2/c1-12-6-2-3-7-14(12)18-11-13(10-15(18)19)16(20)17-8-4-5-9-17/h2-3,6-7,13H,4-5,8-11H2,1H3 |
| InChIKey | GHIDNAVYIZVNRX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |