C30H30BCl2NO4 — CID 170810792
9H-fluoren-9-ylmethyl N-[3-(3,5-dichlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810792) has the molecular formula C30H30BCl2NO4 and a molecular weight of 550.29 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(3,5-dichlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(3,5-dichlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810792 |
| Molecular Formula | C30H30BCl2NO4 |
| Molecular Weight | 550.29 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(3,5-dichlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cc(Cl)cc(Cl)c2)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C30H30BCl2NO4/c1-29(2)30(3,4)38-31(37-29)20(13-19-14-21(32)16-22(33)15-19)17-34-28(35)36-18-27-25-11-7-5-9-23(25)24-10-6-8-12-26(24)27/h5-16,27H,17-18H2,1-4H3,(H,34,35) |
| InChIKey | CERZITBEJKHRLP-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.29 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|