C19H29N3O5S — CID 17081244
1-tert-butyl-N-[4-(3-methoxypropylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 17081244) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is 1-tert-butyl-N-[4-(3-methoxypropylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[4-(3-methoxypropylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17081244 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-tert-butyl-N-[4-(3-methoxypropylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COCCCNS(=O)(=O)c1ccc(NC(=O)C2CC(=O)N(C(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C19H29N3O5S/c1-19(2,3)22-13-14(12-17(22)23)18(24)21-15-6-8-16(9-7-15)28(25,26)20-10-5-11-27-4/h6-9,14,20H,5,10-13H2,1-4H3,(H,21,24) |
| InChIKey | STGLZMKDJFSBRF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|