C13H21ClN2O2 — CID 17081353
N-(3-chloropropyl)-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 17081353) has the molecular formula C13H21ClN2O2 and a molecular weight of 272.78 g/mol. Its IUPAC name is N-(3-chloropropyl)-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(3-chloropropyl)-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17081353 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(3-chloropropyl)-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCCl)C1CC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C13H21ClN2O2/c14-6-3-7-15-13(18)10-8-12(17)16(9-10)11-4-1-2-5-11/h10-11H,1-9H2,(H,15,18) |
| InChIKey | POGYKVCWYQSWRF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|