C8H10O5 — CID 170817306
3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde (PubChem CID 170817306) has the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. Its IUPAC name is 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde.
| Compound Name | 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 170817306 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde |
| SMILES | O=Cc1occc1C(O)C(O)CO |
| InChI | InChI=1S/C8H10O5/c9-3-6(11)8(12)5-1-2-13-7(5)4-10/h1-2,4,6,8-9,11-12H,3H2 |
| InChIKey | ZQIBLGGQLNEHTQ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|