About 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde
3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde (PubChem CID 170817306) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde.
Molecular Properties
| Compound Name | 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde |
| PubChem CID | 170817306 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde |
| SMILES | O=Cc1occc1C(O)C(O)CO |
| InChI | InChI=1S/C8H10O5/c9-3-6(11)8(12)5-1-2-13-7(5)4-10/h1-2,4,6,8-9,11-12H,3H2 |
| InChIKey | ZQIBLGGQLNEHTQ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde?
The IUPAC name of 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde (CID 170817306) is 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde.
What is the SMILES notation for 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde?
The canonical SMILES for 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde is O=Cc1occc1C(O)C(O)CO.
What is the InChIKey of 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde?
The InChIKey is ZQIBLGGQLNEHTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5/c9-3-6(11)8(12)5-1-2-13-7(5)4-10/h1-2,4,6,8-9,11-12H,3H2.
What are the key properties of 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde?
3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde has a molecular weight of 186.16 g/mol, XLogP of -0.52, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,3-trihydroxypropyl)furan-2-carbaldehyde is sourced from PubChem (CID 170817306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).