About 4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one
4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one (PubChem CID 170817384) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is 4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one |
| PubChem CID | 170817384 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(C(O)C(O)CO)cc[nH]1 |
| InChI | InChI=1S/C8H11NO4/c10-4-6(11)8(13)5-1-2-9-7(12)3-5/h1-3,6,8,10-11,13H,4H2,(H,9,12) |
| InChIKey | DWNPASGZNSIRQK-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one?
The IUPAC name of 4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one (CID 170817384) is 4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one.
What is the SMILES notation for 4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one?
The canonical SMILES for 4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one is O=c1cc(C(O)C(O)CO)cc[nH]1.
What is the InChIKey of 4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one?
The InChIKey is DWNPASGZNSIRQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4/c10-4-6(11)8(13)5-1-2-9-7(12)3-5/h1-3,6,8,10-11,13H,4H2,(H,9,12).
What are the key properties of 4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one?
4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one has a molecular weight of 185.18 g/mol, XLogP of -1.24, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,3-trihydroxypropyl)-1H-pyridin-2-one is sourced from PubChem (CID 170817384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).