About 3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde
3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde (PubChem CID 170818118) has the molecular formula C10H11FO5
and a molecular weight of 230.19 g/mol. Its IUPAC name is 3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde.
Molecular Properties
| Compound Name | 3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde |
| PubChem CID | 170818118 |
| Molecular Formula | C10H11FO5 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde |
| SMILES | O=Cc1cc(C(O)C(O)CO)cc(F)c1O |
| InChI | InChI=1S/C10H11FO5/c11-7-2-5(10(16)8(14)4-13)1-6(3-12)9(7)15/h1-3,8,10,13-16H,4H2 |
| InChIKey | WQDVVMVJQGKVLI-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde?
The IUPAC name of 3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde (CID 170818118) is 3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde.
What is the SMILES notation for 3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde?
The canonical SMILES for 3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde is O=Cc1cc(C(O)C(O)CO)cc(F)c1O.
What is the InChIKey of 3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde?
The InChIKey is WQDVVMVJQGKVLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO5/c11-7-2-5(10(16)8(14)4-13)1-6(3-12)9(7)15/h1-3,8,10,13-16H,4H2.
What are the key properties of 3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde?
3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde has a molecular weight of 230.19 g/mol, XLogP of -0.27, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-hydroxy-5-(1,2,3-trihydroxypropyl)benzaldehyde is sourced from PubChem (CID 170818118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).