C11H16N2O4 — CID 170818483
N-[6-methyl-5-(1,2,3-trihydroxypropyl)-2-pyridinyl]acetamide (PubChem CID 170818483) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-[6-methyl-5-(1,2,3-trihydroxypropyl)-2-pyridinyl]acetamide.
| Compound Name | N-[6-methyl-5-(1,2,3-trihydroxypropyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 170818483 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-[6-methyl-5-(1,2,3-trihydroxypropyl)-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(O)C(O)CO)c(C)n1 |
| InChI | InChI=1S/C11H16N2O4/c1-6-8(11(17)9(16)5-14)3-4-10(12-6)13-7(2)15/h3-4,9,11,14,16-17H,5H2,1-2H3,(H,12,13,15) |
| InChIKey | BYUHMMJUVGAXIF-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |