About 1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol
1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol (PubChem CID 170819150) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol.
Molecular Properties
| Compound Name | 1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol |
| PubChem CID | 170819150 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol |
| SMILES | C#CCOc1ccc(C(O)C(O)CO)cc1 |
| InChI | InChI=1S/C12H14O4/c1-2-7-16-10-5-3-9(4-6-10)12(15)11(14)8-13/h1,3-6,11-15H,7-8H2 |
| InChIKey | COTMIKCTPZTCBD-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol?
The IUPAC name of 1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol (CID 170819150) is 1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol.
What is the SMILES notation for 1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol?
The canonical SMILES for 1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol is C#CCOc1ccc(C(O)C(O)CO)cc1.
What is the InChIKey of 1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol?
The InChIKey is COTMIKCTPZTCBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-2-7-16-10-5-3-9(4-6-10)12(15)11(14)8-13/h1,3-6,11-15H,7-8H2.
What are the key properties of 1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol?
1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol has a molecular weight of 222.24 g/mol, XLogP of 0.09, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-prop-2-ynoxyphenyl)propane-1,2,3-triol is sourced from PubChem (CID 170819150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).