About 4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid
4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid (PubChem CID 170819638) has the molecular formula C7H9NO4S2
and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid |
| PubChem CID | 170819638 |
| Molecular Formula | C7H9NO4S2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc(C(O)C(O)CS)cs1 |
| InChI | InChI=1S/C7H9NO4S2/c9-4(1-13)5(10)3-2-14-6(8-3)7(11)12/h2,4-5,9-10,13H,1H2,(H,11,12) |
| InChIKey | SKZOITWKHOSNNO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid (CID 170819638) is 4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid is O=C(O)c1nc(C(O)C(O)CS)cs1.
What is the InChIKey of 4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid?
The InChIKey is SKZOITWKHOSNNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4S2/c9-4(1-13)5(10)3-2-14-6(8-3)7(11)12/h2,4-5,9-10,13H,1H2,(H,11,12).
What are the key properties of 4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid?
4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid has a molecular weight of 235.29 g/mol, XLogP of 0.17, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 170819638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).