C19H18Cl2N2O2 — CID 17081984
N-(3,5-dichlorophenyl)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 17081984) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17081984 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | N-(3,5-dichlorophenyl)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCc1ccc(N2CC(C(=O)Nc3cc(Cl)cc(Cl)c3)CC2=O)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O2/c1-2-12-3-5-17(6-4-12)23-11-13(7-18(23)24)19(25)22-16-9-14(20)8-15(21)10-16/h3-6,8-10,13H,2,7,11H2,1H3,(H,22,25) |
| InChIKey | WOEFTYYNDLCRTG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |