C12H13NO2S — CID 170820099
1-isoquinolin-4-yl-3-sulfanylpropane-1,2-diol (PubChem CID 170820099) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 1-isoquinolin-4-yl-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-isoquinolin-4-yl-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170820099 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 1-isoquinolin-4-yl-3-sulfanylpropane-1,2-diol |
| SMILES | OC(CS)C(O)c1cncc2ccccc12 |
| InChI | InChI=1S/C12H13NO2S/c14-11(7-16)12(15)10-6-13-5-8-3-1-2-4-9(8)10/h1-6,11-12,14-16H,7H2 |
| InChIKey | GIYBSGNSDRVWIF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|