C18H28O2S — CID 170820912
1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-3-sulfanylpropane-1,2-diol (PubChem CID 170820912) has the molecular formula C18H28O2S and a molecular weight of 308.49 g/mol. Its IUPAC name is 1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170820912 |
| Molecular Formula | C18H28O2S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-3-sulfanylpropane-1,2-diol |
| SMILES | Cc1cc2c(cc1C(O)C(O)CS)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C18H28O2S/c1-11-8-13-14(9-12(11)16(20)15(19)10-21)18(4,5)7-6-17(13,2)3/h8-9,15-16,19-21H,6-7,10H2,1-5H3 |
| InChIKey | UXXIPPZVPPUJGZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|