C16H23NO3S — CID 170822759
S-[2,3-dihydroxy-3-(4-piperidin-4-ylphenyl)propyl] ethanethioate (PubChem CID 170822759) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(4-piperidin-4-ylphenyl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(4-piperidin-4-ylphenyl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170822759 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | S-[2,3-dihydroxy-3-(4-piperidin-4-ylphenyl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C16H23NO3S/c1-11(18)21-10-15(19)16(20)14-4-2-12(3-5-14)13-6-8-17-9-7-13/h2-5,13,15-17,19-20H,6-10H2,1H3 |
| InChIKey | DWWLVADHTSHCPK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|