C9H11NO5 — CID 170823762
2,3-dihydroxy-3-(2-methoxy-3-pyridinyl)propanoic acid (PubChem CID 170823762) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(2-methoxy-3-pyridinyl)propanoic acid.
| Compound Name | 2,3-dihydroxy-3-(2-methoxy-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 170823762 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2,3-dihydroxy-3-(2-methoxy-3-pyridinyl)propanoic acid |
| SMILES | COc1ncccc1C(O)C(O)C(=O)O |
| InChI | InChI=1S/C9H11NO5/c1-15-8-5(3-2-4-10-8)6(11)7(12)9(13)14/h2-4,6-7,11-12H,1H3,(H,13,14) |
| InChIKey | OCIGMRHQQGLATE-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |