About 2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid
2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid (PubChem CID 170824195) has the molecular formula C11H11NO5
and a molecular weight of 237.21 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid.
Molecular Properties
| Compound Name | 2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid |
| PubChem CID | 170824195 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid |
| SMILES | O=C1NCc2ccc(C(O)C(O)C(=O)O)cc21 |
| InChI | InChI=1S/C11H11NO5/c13-8(9(14)11(16)17)5-1-2-6-4-12-10(15)7(6)3-5/h1-3,8-9,13-14H,4H2,(H,12,15)(H,16,17) |
| InChIKey | QZXVZCQOYFERQJ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid?
The IUPAC name of 2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid (CID 170824195) is 2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid.
What is the SMILES notation for 2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid?
The canonical SMILES for 2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid is O=C1NCc2ccc(C(O)C(O)C(=O)O)cc21.
What is the InChIKey of 2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid?
The InChIKey is QZXVZCQOYFERQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO5/c13-8(9(14)11(16)17)5-1-2-6-4-12-10(15)7(6)3-5/h1-3,8-9,13-14H,4H2,(H,12,15)(H,16,17).
What are the key properties of 2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid?
2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid has a molecular weight of 237.21 g/mol, XLogP of -0.59, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-3-(3-oxo-1,2-dihydroisoindol-5-yl)propanoic acid is sourced from PubChem (CID 170824195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).