About 3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol
3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol (PubChem CID 170826198) has the molecular formula C9H10N6O2
and a molecular weight of 234.22 g/mol. Its IUPAC name is 3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol.
Molecular Properties
| Compound Name | 3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol |
| PubChem CID | 170826198 |
| Molecular Formula | C9H10N6O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1cnn2cccnc12 |
| InChI | InChI=1S/C9H10N6O2/c10-14-12-5-7(16)8(17)6-4-13-15-3-1-2-11-9(6)15/h1-4,7-8,16-17H,5H2 |
| InChIKey | JGBAXQUVRAKXGF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol?
The IUPAC name of 3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol (CID 170826198) is 3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol.
What is the SMILES notation for 3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol?
The canonical SMILES for 3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol is [N-]=[N+]=NCC(O)C(O)c1cnn2cccnc12.
What is the InChIKey of 3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol?
The InChIKey is JGBAXQUVRAKXGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N6O2/c10-14-12-5-7(16)8(17)6-4-13-15-3-1-2-11-9(6)15/h1-4,7-8,16-17H,5H2.
What are the key properties of 3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol?
3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol has a molecular weight of 234.22 g/mol, XLogP of 0.43, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azido-1-pyrazolo[1,5-a]pyrimidin-3-ylpropane-1,2-diol is sourced from PubChem (CID 170826198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).