C19H29N3O4S — CID 17082636
1-butyl-N-[4-(tert-butylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 17082636) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-butyl-N-[4-(tert-butylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-butyl-N-[4-(tert-butylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17082636 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-butyl-N-[4-(tert-butylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCCCN1CC(C(=O)Nc2ccc(S(=O)(=O)NC(C)(C)C)cc2)CC1=O |
| InChI | InChI=1S/C19H29N3O4S/c1-5-6-11-22-13-14(12-17(22)23)18(24)20-15-7-9-16(10-8-15)27(25,26)21-19(2,3)4/h7-10,14,21H,5-6,11-13H2,1-4H3,(H,20,24) |
| InChIKey | QAIXOOFECBSSTM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |