C9H14N2O2 — CID 170827559
3-amino-1-(2-methyl-4-pyridinyl)propane-1,2-diol (PubChem CID 170827559) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-amino-1-(2-methyl-4-pyridinyl)propane-1,2-diol.
| Compound Name | 3-amino-1-(2-methyl-4-pyridinyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170827559 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-amino-1-(2-methyl-4-pyridinyl)propane-1,2-diol |
| SMILES | Cc1cc(C(O)C(O)CN)ccn1 |
| InChI | InChI=1S/C9H14N2O2/c1-6-4-7(2-3-11-6)9(13)8(12)5-10/h2-4,8-9,12-13H,5,10H2,1H3 |
| InChIKey | GMLGUUKQLXLMLA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |