C11H14N2O2 — CID 170828080
2-(3-amino-1,2-dihydroxypropyl)-3-methylbenzonitrile (PubChem CID 170828080) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(3-amino-1,2-dihydroxypropyl)-3-methylbenzonitrile.
| Compound Name | 2-(3-amino-1,2-dihydroxypropyl)-3-methylbenzonitrile |
|---|---|
| PubChem CID | 170828080 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(3-amino-1,2-dihydroxypropyl)-3-methylbenzonitrile |
| SMILES | Cc1cccc(C#N)c1C(O)C(O)CN |
| InChI | InChI=1S/C11H14N2O2/c1-7-3-2-4-8(5-12)10(7)11(15)9(14)6-13/h2-4,9,11,14-15H,6,13H2,1H3 |
| InChIKey | UUKFRKQANKMGJI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |