About 5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde
5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde (PubChem CID 170828295) has the molecular formula C10H12FNO4
and a molecular weight of 229.21 g/mol. Its IUPAC name is 5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | 5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde |
| PubChem CID | 170828295 |
| Molecular Formula | C10H12FNO4 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde |
| SMILES | NCC(O)C(O)c1cc(F)c(O)c(C=O)c1 |
| InChI | InChI=1S/C10H12FNO4/c11-7-2-5(10(16)8(14)3-12)1-6(4-13)9(7)15/h1-2,4,8,10,14-16H,3,12H2 |
| InChIKey | NERCADRHYZQTCQ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde?
The IUPAC name of 5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde (CID 170828295) is 5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde.
What is the SMILES notation for 5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde?
The canonical SMILES for 5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde is NCC(O)C(O)c1cc(F)c(O)c(C=O)c1.
What is the InChIKey of 5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde?
The InChIKey is NERCADRHYZQTCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO4/c11-7-2-5(10(16)8(14)3-12)1-6(4-13)9(7)15/h1-2,4,8,10,14-16H,3,12H2.
What are the key properties of 5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde?
5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde has a molecular weight of 229.21 g/mol, XLogP of -0.30, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-amino-1,2-dihydroxypropyl)-3-fluoro-2-hydroxybenzaldehyde is sourced from PubChem (CID 170828295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).