About methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate
methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate (PubChem CID 170828696) has the molecular formula C11H16N2O4
and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate |
| PubChem CID | 170828696 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(C(O)C(O)CN)cc1C |
| InChI | InChI=1S/C11H16N2O4/c1-6-3-7(10(15)8(14)4-12)5-13-9(6)11(16)17-2/h3,5,8,10,14-15H,4,12H2,1-2H3 |
| InChIKey | JHCDTYBPCNSQDE-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate?
The IUPAC name of methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate (CID 170828696) is methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate.
What is the SMILES notation for methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate?
The canonical SMILES for methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate is COC(=O)c1ncc(C(O)C(O)CN)cc1C.
What is the InChIKey of methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate?
The InChIKey is JHCDTYBPCNSQDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4/c1-6-3-7(10(15)8(14)4-12)5-13-9(6)11(16)17-2/h3,5,8,10,14-15H,4,12H2,1-2H3.
What are the key properties of methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate?
methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate has a molecular weight of 240.26 g/mol, XLogP of -0.47, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(3-amino-1,2-dihydroxypropyl)-3-methylpyridine-2-carboxylate is sourced from PubChem (CID 170828696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).