C17H21NO4 — CID 170829202
3-amino-1-(3-methoxy-4-phenylmethoxyphenyl)propane-1,2-diol (PubChem CID 170829202) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-amino-1-(3-methoxy-4-phenylmethoxyphenyl)propane-1,2-diol.
| Compound Name | 3-amino-1-(3-methoxy-4-phenylmethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170829202 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 3-amino-1-(3-methoxy-4-phenylmethoxyphenyl)propane-1,2-diol |
| SMILES | COc1cc(C(O)C(O)CN)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C17H21NO4/c1-21-16-9-13(17(20)14(19)10-18)7-8-15(16)22-11-12-5-3-2-4-6-12/h2-9,14,17,19-20H,10-11,18H2,1H3 |
| InChIKey | IESPQKSSAGTLOF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |