C20H17FN4O6 — CID 17083354
3-(1,3-benzodioxol-5-yl)-N-[2-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083354) has the molecular formula C20H17FN4O6 and a molecular weight of 428.38 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[2-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083354 |
| Molecular Formula | C20H17FN4O6 |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(COc1ccc(F)cc1)NCCNC(=O)c1nc(-c2ccc3c(c2)OCO3)no1 |
| InChI | InChI=1S/C20H17FN4O6/c21-13-2-4-14(5-3-13)28-10-17(26)22-7-8-23-19(27)20-24-18(25-31-20)12-1-6-15-16(9-12)30-11-29-15/h1-6,9H,7-8,10-11H2,(H,22,26)(H,23,27) |
| InChIKey | OCEZPALCBGSJMY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|