C21H17F3N4O6 — CID 17083360
3-(1,3-benzodioxol-5-yl)-N-[2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083360) has the molecular formula C21H17F3N4O6 and a molecular weight of 478.38 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083360 |
| Molecular Formula | C21H17F3N4O6 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(COc1cccc(C(F)(F)F)c1)NCCNC(=O)c1nc(-c2ccc3c(c2)OCO3)no1 |
| InChI | InChI=1S/C21H17F3N4O6/c22-21(23,24)13-2-1-3-14(9-13)31-10-17(29)25-6-7-26-19(30)20-27-18(28-34-20)12-4-5-15-16(8-12)33-11-32-15/h1-5,8-9H,6-7,10-11H2,(H,25,29)(H,26,30) |
| InChIKey | GWNJLMPZFBSFGO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|