C25H40 — CID 170835673
(1R,2S,4R,7S,10R,11S,12S,13S,15S)-4,7,15-trimethyl-18-methylidene-10-propan-2-ylpentacyclo[13.2.1.02,13.04,12.07,11]octadecane (PubChem CID 170835673) has the molecular formula C25H40 and a molecular weight of 340.60 g/mol. Its IUPAC name is (1R,2S,4R,7S,10R,11S,12S,13S,15S)-4,7,15-trimethyl-18-methylidene-10-propan-2-ylpentacyclo[13.2.1.02,13.04,12.07,11]octadecane.
| Compound Name | (1R,2S,4R,7S,10R,11S,12S,13S,15S)-4,7,15-trimethyl-18-methylidene-10-propan-2-ylpentacyclo[13.2.1.02,13.04,12.07,11]octadecane |
|---|---|
| PubChem CID | 170835673 |
| Molecular Formula | C25H40 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | (1R,2S,4R,7S,10R,11S,12S,13S,15S)-4,7,15-trimethyl-18-methylidene-10-propan-2-ylpentacyclo[13.2.1.02,13.04,12.07,11]octadecane |
| SMILES | C=C1[C@@H]2CC[C@@]1(C)C[C@H]1[C@@H]2C[C@@]2(C)CC[C@]3(C)CC[C@H](C(C)C)[C@H]3[C@H]12 |
| InChI | InChI=1S/C25H40/c1-15(2)17-7-9-23(4)11-12-25(6)13-19-18-8-10-24(5,16(18)3)14-20(19)22(25)21(17)23/h15,17-22H,3,7-14H2,1-2,4-6H3/t17-,18+,19-,20+,21+,22+,23+,24+,25-/m1/s1 |
| InChIKey | DCBBVKKSKRUHOH-NSOPITQOSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|