C23H25BrN4O4 — CID 17083627
N-[2-[[2-(4-bromophenoxy)acetyl]amino]ethyl]-3-(4-tert-butylphenyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083627) has the molecular formula C23H25BrN4O4 and a molecular weight of 501.38 g/mol. Its IUPAC name is N-[2-[[2-(4-bromophenoxy)acetyl]amino]ethyl]-3-(4-tert-butylphenyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[[2-(4-bromophenoxy)acetyl]amino]ethyl]-3-(4-tert-butylphenyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083627 |
| Molecular Formula | C23H25BrN4O4 |
| Molecular Weight | 501.38 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | N-[2-[[2-(4-bromophenoxy)acetyl]amino]ethyl]-3-(4-tert-butylphenyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CC(C)(C)c1ccc(-c2noc(C(=O)NCCNC(=O)COc3ccc(Br)cc3)n2)cc1 |
| InChI | InChI=1S/C23H25BrN4O4/c1-23(2,3)16-6-4-15(5-7-16)20-27-22(32-28-20)21(30)26-13-12-25-19(29)14-31-18-10-8-17(24)9-11-18/h4-11H,12-14H2,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | GZYXRWXEYJANAG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|