C11H8BrF3O4 — CID 170837299
2-(1-bromo-2-oxopropyl)-6-(trifluoromethoxy)benzoic acid (PubChem CID 170837299) has the molecular formula C11H8BrF3O4 and a molecular weight of 341.08 g/mol. Its IUPAC name is 2-(1-bromo-2-oxopropyl)-6-(trifluoromethoxy)benzoic acid.
| Compound Name | 2-(1-bromo-2-oxopropyl)-6-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 170837299 |
| Molecular Formula | C11H8BrF3O4 |
| Molecular Weight | 341.08 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 2-(1-bromo-2-oxopropyl)-6-(trifluoromethoxy)benzoic acid |
| SMILES | CC(=O)C(Br)c1cccc(OC(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C11H8BrF3O4/c1-5(16)9(12)6-3-2-4-7(8(6)10(17)18)19-11(13,14)15/h2-4,9H,1H3,(H,17,18) |
| InChIKey | PTKYZNVHIGRCAE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.08 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|